C14H24N2O5 — CID 140855256
tert-butyl (3S,4aS,7aS)-3-hydroxy-6-(2-hydroxyethyl)-7-oxo-2,3,4,4a,5,7a-hexahydropyrrolo[3,4-b]pyridine-1-carboxylate (PubChem CID 140855256) has the molecular formula C14H24N2O5 and a molecular weight of 300.36 g/mol. Its IUPAC name is tert-butyl (3S,4aS,7aS)-3-hydroxy-6-(2-hydroxyethyl)-7-oxo-2,3,4,4a,5,7a-hexahydropyrrolo[3,4-b]pyridine-1-carboxylate.
| Compound Name | tert-butyl (3S,4aS,7aS)-3-hydroxy-6-(2-hydroxyethyl)-7-oxo-2,3,4,4a,5,7a-hexahydropyrrolo[3,4-b]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 140855256 |
| Molecular Formula | C14H24N2O5 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | tert-butyl (3S,4aS,7aS)-3-hydroxy-6-(2-hydroxyethyl)-7-oxo-2,3,4,4a,5,7a-hexahydropyrrolo[3,4-b]pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](O)C[C@H]2CN(CCO)C(=O)[C@H]21 |
| InChI | InChI=1S/C14H24N2O5/c1-14(2,3)21-13(20)16-8-10(18)6-9-7-15(4-5-17)12(19)11(9)16/h9-11,17-18H,4-8H2,1-3H3/t9-,10-,11-/m0/s1 |
| InChIKey | HAJYTQVMBUGENX-DCAQKATOSA-N |
| XLogP | -0.19 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |