C35H49NO6 — CID 140857362
(2S,3R,4S,5S)-3-tert-butyl-4-[(5-tert-butyl-2-methoxyphenyl)methoxy]-1-[(1R,3R)-3-methoxycyclohexanecarbonyl]-5-phenylpyrrolidine-2-carboxylic acid (PubChem CID 140857362) has the molecular formula C35H49NO6 and a molecular weight of 579.78 g/mol. Its IUPAC name is (2S,3R,4S,5S)-3-tert-butyl-4-[(5-tert-butyl-2-methoxyphenyl)methoxy]-1-[(1R,3R)-3-methoxycyclohexanecarbonyl]-5-phenylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3R,4S,5S)-3-tert-butyl-4-[(5-tert-butyl-2-methoxyphenyl)methoxy]-1-[(1R,3R)-3-methoxycyclohexanecarbonyl]-5-phenylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 140857362 |
| Molecular Formula | C35H49NO6 |
| Molecular Weight | 579.78 g/mol |
| Exact Mass | 579.36 |
| IUPAC Name | (2S,3R,4S,5S)-3-tert-butyl-4-[(5-tert-butyl-2-methoxyphenyl)methoxy]-1-[(1R,3R)-3-methoxycyclohexanecarbonyl]-5-phenylpyrrolidine-2-carboxylic acid |
| SMILES | COc1ccc(C(C)(C)C)cc1CO[C@H]1[C@H](C(C)(C)C)[C@@H](C(=O)O)N(C(=O)[C@@H]2CCC[C@@H](OC)C2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C35H49NO6/c1-34(2,3)25-17-18-27(41-8)24(19-25)21-42-31-28(35(4,5)6)30(33(38)39)36(29(31)22-13-10-9-11-14-22)32(37)23-15-12-16-26(20-23)40-7/h9-11,13-14,17-19,23,26,28-31H,12,15-16,20-21H2,1-8H3,(H,38,39)/t23-,26-,28-,29+,30+,31+/m1/s1 |
| InChIKey | OZXVWJMEDTYACV-ORRYPCBVSA-N |
| XLogP | 6.78 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.78 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |