C37H45NO6 — CID 139443408
(2S,3R,4S,5S)-3-tert-butyl-1-[(1R,3R)-3-methoxycyclohexanecarbonyl]-4-[(2-methoxy-5-phenylphenyl)methoxy]-5-phenylpyrrolidine-2-carboxylic acid (PubChem CID 139443408) has the molecular formula C37H45NO6 and a molecular weight of 599.77 g/mol. Its IUPAC name is (2S,3R,4S,5S)-3-tert-butyl-1-[(1R,3R)-3-methoxycyclohexanecarbonyl]-4-[(2-methoxy-5-phenylphenyl)methoxy]-5-phenylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3R,4S,5S)-3-tert-butyl-1-[(1R,3R)-3-methoxycyclohexanecarbonyl]-4-[(2-methoxy-5-phenylphenyl)methoxy]-5-phenylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 139443408 |
| Molecular Formula | C37H45NO6 |
| Molecular Weight | 599.77 g/mol |
| Exact Mass | 599.32 |
| IUPAC Name | (2S,3R,4S,5S)-3-tert-butyl-1-[(1R,3R)-3-methoxycyclohexanecarbonyl]-4-[(2-methoxy-5-phenylphenyl)methoxy]-5-phenylpyrrolidine-2-carboxylic acid |
| SMILES | COc1ccc(-c2ccccc2)cc1CO[C@H]1[C@H](C(C)(C)C)[C@@H](C(=O)O)N(C(=O)[C@@H]2CCC[C@@H](OC)C2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C37H45NO6/c1-37(2,3)31-33(36(40)41)38(35(39)27-17-12-18-29(22-27)42-4)32(25-15-10-7-11-16-25)34(31)44-23-28-21-26(19-20-30(28)43-5)24-13-8-6-9-14-24/h6-11,13-16,19-21,27,29,31-34H,12,17-18,22-23H2,1-5H3,(H,40,41)/t27-,29-,31-,32+,33+,34+/m1/s1 |
| InChIKey | RNGAKLPDDGJHFZ-YBVUDNBOSA-N |
| XLogP | 7.15 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.77 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |