C34H44N2O5 — CID 140857945
(2S,3S,4S,5S)-3-tert-butyl-1-(cyclohexanecarbonyl)-4-[[5-(2,5-dihydrofuran-3-yl)-2-methoxyphenyl]methylamino]-5-phenylpyrrolidine-2-carboxylic acid (PubChem CID 140857945) has the molecular formula C34H44N2O5 and a molecular weight of 560.74 g/mol. Its IUPAC name is (2S,3S,4S,5S)-3-tert-butyl-1-(cyclohexanecarbonyl)-4-[[5-(2,5-dihydrofuran-3-yl)-2-methoxyphenyl]methylamino]-5-phenylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5S)-3-tert-butyl-1-(cyclohexanecarbonyl)-4-[[5-(2,5-dihydrofuran-3-yl)-2-methoxyphenyl]methylamino]-5-phenylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 140857945 |
| Molecular Formula | C34H44N2O5 |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.33 |
| IUPAC Name | (2S,3S,4S,5S)-3-tert-butyl-1-(cyclohexanecarbonyl)-4-[[5-(2,5-dihydrofuran-3-yl)-2-methoxyphenyl]methylamino]-5-phenylpyrrolidine-2-carboxylic acid |
| SMILES | COc1ccc(C2=CCOC2)cc1CN[C@H]1[C@H](C(C)(C)C)[C@@H](C(=O)O)N(C(=O)C2CCCCC2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C34H44N2O5/c1-34(2,3)28-29(35-20-26-19-24(15-16-27(26)40-4)25-17-18-41-21-25)30(22-11-7-5-8-12-22)36(31(28)33(38)39)32(37)23-13-9-6-10-14-23/h5,7-8,11-12,15-17,19,23,28-31,35H,6,9-10,13-14,18,20-21H2,1-4H3,(H,38,39)/t28-,29-,30-,31-/m0/s1 |
| InChIKey | JNGNGMPIGZFBQX-ORYMTKCHSA-N |
| XLogP | 5.85 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |