C34H47N3O7 — CID 140857463
2-O-ethyl 1-O-prop-2-enyl (2S,3R,4R,5S)-3-tert-butyl-4-[(5-cyclobutyl-2-methoxy-3-pyridinyl)methoxy]-5-(2-propan-2-yloxy-3-pyridinyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 140857463) has the molecular formula C34H47N3O7 and a molecular weight of 609.76 g/mol. Its IUPAC name is 2-O-ethyl 1-O-prop-2-enyl (2S,3R,4R,5S)-3-tert-butyl-4-[(5-cyclobutyl-2-methoxy-3-pyridinyl)methoxy]-5-(2-propan-2-yloxy-3-pyridinyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-ethyl 1-O-prop-2-enyl (2S,3R,4R,5S)-3-tert-butyl-4-[(5-cyclobutyl-2-methoxy-3-pyridinyl)methoxy]-5-(2-propan-2-yloxy-3-pyridinyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 140857463 |
| Molecular Formula | C34H47N3O7 |
| Molecular Weight | 609.76 g/mol |
| Exact Mass | 609.34 |
| IUPAC Name | 2-O-ethyl 1-O-prop-2-enyl (2S,3R,4R,5S)-3-tert-butyl-4-[(5-cyclobutyl-2-methoxy-3-pyridinyl)methoxy]-5-(2-propan-2-yloxy-3-pyridinyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | C=CCOC(=O)N1[C@H](C(=O)OCC)[C@@H](C(C)(C)C)[C@@H](OCc2cc(C3CCC3)cnc2OC)[C@@H]1c1cccnc1OC(C)C |
| InChI | InChI=1S/C34H47N3O7/c1-9-17-42-33(39)37-27(25-15-12-16-35-31(25)44-21(3)4)29(26(34(5,6)7)28(37)32(38)41-10-2)43-20-24-18-23(22-13-11-14-22)19-36-30(24)40-8/h9,12,15-16,18-19,21-22,26-29H,1,10-11,13-14,17,20H2,2-8H3/t26-,27+,28+,29-/m1/s1 |
| InChIKey | REWRAUWFQIMSLD-GIFPIDKJSA-N |
| XLogP | 6.40 |
| TPSA | 109.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.76 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|