C33H43F3N2O6 — CID 140857595
2-O-ethyl 1-O-prop-2-enyl (2S,3R,4S,5S)-3-tert-butyl-5-(3-tert-butylphenyl)-4-[[2-methoxy-5-(trifluoromethyl)-3-pyridinyl]methoxy]pyrrolidine-1,2-dicarboxylate (PubChem CID 140857595) has the molecular formula C33H43F3N2O6 and a molecular weight of 620.71 g/mol. Its IUPAC name is 2-O-ethyl 1-O-prop-2-enyl (2S,3R,4S,5S)-3-tert-butyl-5-(3-tert-butylphenyl)-4-[[2-methoxy-5-(trifluoromethyl)-3-pyridinyl]methoxy]pyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-ethyl 1-O-prop-2-enyl (2S,3R,4S,5S)-3-tert-butyl-5-(3-tert-butylphenyl)-4-[[2-methoxy-5-(trifluoromethyl)-3-pyridinyl]methoxy]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 140857595 |
| Molecular Formula | C33H43F3N2O6 |
| Molecular Weight | 620.71 g/mol |
| Exact Mass | 620.31 |
| IUPAC Name | 2-O-ethyl 1-O-prop-2-enyl (2S,3R,4S,5S)-3-tert-butyl-5-(3-tert-butylphenyl)-4-[[2-methoxy-5-(trifluoromethyl)-3-pyridinyl]methoxy]pyrrolidine-1,2-dicarboxylate |
| SMILES | C=CCOC(=O)N1[C@H](C(=O)OCC)[C@@H](C(C)(C)C)[C@H](OCc2cc(C(F)(F)F)cnc2OC)[C@@H]1c1cccc(C(C)(C)C)c1 |
| InChI | InChI=1S/C33H43F3N2O6/c1-10-15-43-30(40)38-25(20-13-12-14-22(16-20)31(3,4)5)27(24(32(6,7)8)26(38)29(39)42-11-2)44-19-21-17-23(33(34,35)36)18-37-28(21)41-9/h10,12-14,16-18,24-27H,1,11,15,19H2,2-9H3/t24-,25+,26+,27+/m1/s1 |
| InChIKey | ZJNOCIROJJHEDZ-WKAQUBQDSA-N |
| XLogP | 7.27 |
| TPSA | 87.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.71 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|