C35H49N3O4 — CID 140857955
(2S,3S,4S,5S)-3-tert-butyl-4-[(5-cyclobutyl-2-methoxy-3-pyridinyl)methylamino]-1-(3,5-dimethylcyclohexanecarbonyl)-5-phenylpyrrolidine-2-carboxylic acid (PubChem CID 140857955) has the molecular formula C35H49N3O4 and a molecular weight of 575.79 g/mol. Its IUPAC name is (2S,3S,4S,5S)-3-tert-butyl-4-[(5-cyclobutyl-2-methoxy-3-pyridinyl)methylamino]-1-(3,5-dimethylcyclohexanecarbonyl)-5-phenylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5S)-3-tert-butyl-4-[(5-cyclobutyl-2-methoxy-3-pyridinyl)methylamino]-1-(3,5-dimethylcyclohexanecarbonyl)-5-phenylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 140857955 |
| Molecular Formula | C35H49N3O4 |
| Molecular Weight | 575.79 g/mol |
| Exact Mass | 575.37 |
| IUPAC Name | (2S,3S,4S,5S)-3-tert-butyl-4-[(5-cyclobutyl-2-methoxy-3-pyridinyl)methylamino]-1-(3,5-dimethylcyclohexanecarbonyl)-5-phenylpyrrolidine-2-carboxylic acid |
| SMILES | COc1ncc(C2CCC2)cc1CN[C@H]1[C@H](C(C)(C)C)[C@@H](C(=O)O)N(C(=O)C2CC(C)CC(C)C2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C35H49N3O4/c1-21-15-22(2)17-25(16-21)33(39)38-30(24-11-8-7-9-12-24)29(28(35(3,4)5)31(38)34(40)41)36-20-27-18-26(23-13-10-14-23)19-37-32(27)42-6/h7-9,11-12,18-19,21-23,25,28-31,36H,10,13-17,20H2,1-6H3,(H,40,41)/t21?,22?,25?,28-,29-,30-,31-/m0/s1 |
| InChIKey | NOSDSEJAWJKNDQ-ZTGCRANMSA-N |
| XLogP | 6.59 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.79 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |