C32H42ClF2N3O3 — CID 140857979
(2S,3S,4S,5S)-3-tert-butyl-4-[(6-tert-butyl-2-chloro-3-pyridinyl)methylamino]-1-[(1R)-3,3-difluorocyclohexanecarbonyl]-5-phenylpyrrolidine-2-carboxylic acid (PubChem CID 140857979) has the molecular formula C32H42ClF2N3O3 and a molecular weight of 590.16 g/mol. Its IUPAC name is (2S,3S,4S,5S)-3-tert-butyl-4-[(6-tert-butyl-2-chloro-3-pyridinyl)methylamino]-1-[(1R)-3,3-difluorocyclohexanecarbonyl]-5-phenylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5S)-3-tert-butyl-4-[(6-tert-butyl-2-chloro-3-pyridinyl)methylamino]-1-[(1R)-3,3-difluorocyclohexanecarbonyl]-5-phenylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 140857979 |
| Molecular Formula | C32H42ClF2N3O3 |
| Molecular Weight | 590.16 g/mol |
| Exact Mass | 589.29 |
| IUPAC Name | (2S,3S,4S,5S)-3-tert-butyl-4-[(6-tert-butyl-2-chloro-3-pyridinyl)methylamino]-1-[(1R)-3,3-difluorocyclohexanecarbonyl]-5-phenylpyrrolidine-2-carboxylic acid |
| SMILES | CC(C)(C)c1ccc(CN[C@H]2[C@H](C(C)(C)C)[C@@H](C(=O)O)N(C(=O)[C@@H]3CCCC(F)(F)C3)[C@H]2c2ccccc2)c(Cl)n1 |
| InChI | InChI=1S/C32H42ClF2N3O3/c1-30(2,3)22-15-14-21(27(33)37-22)18-36-24-23(31(4,5)6)26(29(40)41)38(25(24)19-11-8-7-9-12-19)28(39)20-13-10-16-32(34,35)17-20/h7-9,11-12,14-15,20,23-26,36H,10,13,16-18H2,1-6H3,(H,40,41)/t20-,23+,24+,25+,26+/m1/s1 |
| InChIKey | MXLZUZPDCZUSIJ-GWCXRDAXSA-N |
| XLogP | 7.02 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.16 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|