C30H37NO3 — CID 14086153
pyridin-3-ylmethyl 2,2-dimethyl-6-[4-(4-phenylbutyl)phenoxy]hexanoate (PubChem CID 14086153) has the molecular formula C30H37NO3 and a molecular weight of 459.63 g/mol. Its IUPAC name is pyridin-3-ylmethyl 2,2-dimethyl-6-[4-(4-phenylbutyl)phenoxy]hexanoate.
| Compound Name | pyridin-3-ylmethyl 2,2-dimethyl-6-[4-(4-phenylbutyl)phenoxy]hexanoate |
|---|---|
| PubChem CID | 14086153 |
| Molecular Formula | C30H37NO3 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | pyridin-3-ylmethyl 2,2-dimethyl-6-[4-(4-phenylbutyl)phenoxy]hexanoate |
| SMILES | CC(C)(CCCCOc1ccc(CCCCc2ccccc2)cc1)C(=O)OCc1cccnc1 |
| InChI | InChI=1S/C30H37NO3/c1-30(2,29(32)34-24-27-15-10-21-31-23-27)20-8-9-22-33-28-18-16-26(17-19-28)14-7-6-13-25-11-4-3-5-12-25/h3-5,10-12,15-19,21,23H,6-9,13-14,20,22,24H2,1-2H3 |
| InChIKey | URCIXIYHIRZGCR-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|