C23H19ClN4O — CID 140862149
5-amino-N-(4-chloro-2-phenylphenyl)-1-(2-methylphenyl)pyrazole-4-carboxamide (PubChem CID 140862149) has the molecular formula C23H19ClN4O and a molecular weight of 402.89 g/mol. Its IUPAC name is 5-amino-N-(4-chloro-2-phenylphenyl)-1-(2-methylphenyl)pyrazole-4-carboxamide.
| Compound Name | 5-amino-N-(4-chloro-2-phenylphenyl)-1-(2-methylphenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 140862149 |
| Molecular Formula | C23H19ClN4O |
| Molecular Weight | 402.89 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 5-amino-N-(4-chloro-2-phenylphenyl)-1-(2-methylphenyl)pyrazole-4-carboxamide |
| SMILES | Cc1ccccc1-n1ncc(C(=O)Nc2ccc(Cl)cc2-c2ccccc2)c1N |
| InChI | InChI=1S/C23H19ClN4O/c1-15-7-5-6-10-21(15)28-22(25)19(14-26-28)23(29)27-20-12-11-17(24)13-18(20)16-8-3-2-4-9-16/h2-14H,25H2,1H3,(H,27,29) |
| InChIKey | GFAZABMQWCJUMP-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.89 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |