C24H18N4O — CID 140864357
4-[1-methyl-4-(3-pyridin-2-ylphenyl)benzimidazol-2-yl]pyridin-3-ol (PubChem CID 140864357) has the molecular formula C24H18N4O and a molecular weight of 378.44 g/mol. Its IUPAC name is 4-[1-methyl-4-(3-pyridin-2-ylphenyl)benzimidazol-2-yl]pyridin-3-ol.
| Compound Name | 4-[1-methyl-4-(3-pyridin-2-ylphenyl)benzimidazol-2-yl]pyridin-3-ol |
|---|---|
| PubChem CID | 140864357 |
| Molecular Formula | C24H18N4O |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 4-[1-methyl-4-(3-pyridin-2-ylphenyl)benzimidazol-2-yl]pyridin-3-ol |
| SMILES | Cn1c(-c2ccncc2O)nc2c(-c3cccc(-c4ccccn4)c3)cccc21 |
| InChI | InChI=1S/C24H18N4O/c1-28-21-10-5-8-18(23(21)27-24(28)19-11-13-25-15-22(19)29)16-6-4-7-17(14-16)20-9-2-3-12-26-20/h2-15,29H,1H3 |
| InChIKey | ARIYKKTYHXVGPN-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |