C37H38N4OSi — CID 140865089
4-[4-[3-tert-butyl-5-(4-phenyl-5-trimethylsilyl-2-pyridinyl)phenyl]-1-methylbenzimidazol-2-yl]pyridin-3-ol (PubChem CID 140865089) has the molecular formula C37H38N4OSi and a molecular weight of 582.82 g/mol. Its IUPAC name is 4-[4-[3-tert-butyl-5-(4-phenyl-5-trimethylsilyl-2-pyridinyl)phenyl]-1-methylbenzimidazol-2-yl]pyridin-3-ol.
| Compound Name | 4-[4-[3-tert-butyl-5-(4-phenyl-5-trimethylsilyl-2-pyridinyl)phenyl]-1-methylbenzimidazol-2-yl]pyridin-3-ol |
|---|---|
| PubChem CID | 140865089 |
| Molecular Formula | C37H38N4OSi |
| Molecular Weight | 582.82 g/mol |
| Exact Mass | 582.28 |
| IUPAC Name | 4-[4-[3-tert-butyl-5-(4-phenyl-5-trimethylsilyl-2-pyridinyl)phenyl]-1-methylbenzimidazol-2-yl]pyridin-3-ol |
| SMILES | Cn1c(-c2ccncc2O)nc2c(-c3cc(-c4cc(-c5ccccc5)c([Si](C)(C)C)cn4)cc(C(C)(C)C)c3)cccc21 |
| InChI | InChI=1S/C37H38N4OSi/c1-37(2,3)27-19-25(28-14-11-15-32-35(28)40-36(41(32)4)29-16-17-38-22-33(29)42)18-26(20-27)31-21-30(24-12-9-8-10-13-24)34(23-39-31)43(5,6)7/h8-23,42H,1-7H3 |
| InChIKey | RSGQAWIHPDIXRV-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.82 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|