C52H52N4OSi — CID 140864477
4,6-ditert-butyl-2-[1-phenyl-4-[3-phenyl-5-(4-phenyl-5-trimethylsilyl-2-pyridinyl)phenyl]benzimidazol-2-yl]pyridin-3-ol (PubChem CID 140864477) has the molecular formula C52H52N4OSi and a molecular weight of 777.10 g/mol. Its IUPAC name is 4,6-ditert-butyl-2-[1-phenyl-4-[3-phenyl-5-(4-phenyl-5-trimethylsilyl-2-pyridinyl)phenyl]benzimidazol-2-yl]pyridin-3-ol.
| Compound Name | 4,6-ditert-butyl-2-[1-phenyl-4-[3-phenyl-5-(4-phenyl-5-trimethylsilyl-2-pyridinyl)phenyl]benzimidazol-2-yl]pyridin-3-ol |
|---|---|
| PubChem CID | 140864477 |
| Molecular Formula | C52H52N4OSi |
| Molecular Weight | 777.10 g/mol |
| Exact Mass | 776.39 |
| IUPAC Name | 4,6-ditert-butyl-2-[1-phenyl-4-[3-phenyl-5-(4-phenyl-5-trimethylsilyl-2-pyridinyl)phenyl]benzimidazol-2-yl]pyridin-3-ol |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(O)c(-c2nc3c(-c4cc(-c5ccccc5)cc(-c5cc(-c6ccccc6)c([Si](C)(C)C)cn5)c4)cccc3n2-c2ccccc2)n1 |
| InChI | InChI=1S/C52H52N4OSi/c1-51(2,3)42-32-46(52(4,5)6)54-48(49(42)57)50-55-47-40(26-19-27-44(47)56(50)39-24-17-12-18-25-39)37-28-36(34-20-13-10-14-21-34)29-38(30-37)43-31-41(35-22-15-11-16-23-35)45(33-53-43)58(7,8)9/h10-33,57H,1-9H3 |
| InChIKey | DRPVZICMOBRWQT-UHFFFAOYSA-N |
| XLogP | 13.00 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.10 |
| LogP ≤ 5 | 13.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|