C46H48N4OSi — CID 140864551
4-tert-butyl-2-[7-[3-tert-butyl-5-(4-phenyl-5-trimethylsilyl-2-pyridinyl)phenyl]-3-phenylimidazo[4,5-b]pyridin-2-yl]phenol (PubChem CID 140864551) has the molecular formula C46H48N4OSi and a molecular weight of 701.00 g/mol. Its IUPAC name is 4-tert-butyl-2-[7-[3-tert-butyl-5-(4-phenyl-5-trimethylsilyl-2-pyridinyl)phenyl]-3-phenylimidazo[4,5-b]pyridin-2-yl]phenol.
| Compound Name | 4-tert-butyl-2-[7-[3-tert-butyl-5-(4-phenyl-5-trimethylsilyl-2-pyridinyl)phenyl]-3-phenylimidazo[4,5-b]pyridin-2-yl]phenol |
|---|---|
| PubChem CID | 140864551 |
| Molecular Formula | C46H48N4OSi |
| Molecular Weight | 701.00 g/mol |
| Exact Mass | 700.36 |
| IUPAC Name | 4-tert-butyl-2-[7-[3-tert-butyl-5-(4-phenyl-5-trimethylsilyl-2-pyridinyl)phenyl]-3-phenylimidazo[4,5-b]pyridin-2-yl]phenol |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3ccccc3)c([Si](C)(C)C)cn2)cc(-c2ccnc3c2nc(-c2cc(C(C)(C)C)ccc2O)n3-c2ccccc2)c1 |
| InChI | InChI=1S/C46H48N4OSi/c1-45(2,3)33-20-21-40(51)38(27-33)43-49-42-36(22-23-47-44(42)50(43)35-18-14-11-15-19-35)31-24-32(26-34(25-31)46(4,5)6)39-28-37(30-16-12-10-13-17-30)41(29-48-39)52(7,8)9/h10-29,51H,1-9H3 |
| InChIKey | XUSCLDWSAAKAQL-UHFFFAOYSA-N |
| XLogP | 11.33 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.00 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|