C68H65N3O — CID 164713454
4-tert-butyl-2-[4-[3-tert-butyl-5-[4-[4-(1,1-diphenylethyl)phenyl]-2-pyridinyl]phenyl]-1-(4-tert-butyl-2-phenylphenyl)benzimidazol-2-yl]phenol (PubChem CID 164713454) has the molecular formula C68H65N3O and a molecular weight of 940.29 g/mol. Its IUPAC name is 4-tert-butyl-2-[4-[3-tert-butyl-5-[4-[4-(1,1-diphenylethyl)phenyl]-2-pyridinyl]phenyl]-1-(4-tert-butyl-2-phenylphenyl)benzimidazol-2-yl]phenol.
| Compound Name | 4-tert-butyl-2-[4-[3-tert-butyl-5-[4-[4-(1,1-diphenylethyl)phenyl]-2-pyridinyl]phenyl]-1-(4-tert-butyl-2-phenylphenyl)benzimidazol-2-yl]phenol |
|---|---|
| PubChem CID | 164713454 |
| Molecular Formula | C68H65N3O |
| Molecular Weight | 940.29 g/mol |
| Exact Mass | 939.51 |
| IUPAC Name | 4-tert-butyl-2-[4-[3-tert-butyl-5-[4-[4-(1,1-diphenylethyl)phenyl]-2-pyridinyl]phenyl]-1-(4-tert-butyl-2-phenylphenyl)benzimidazol-2-yl]phenol |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3ccc(C(C)(c4ccccc4)c4ccccc4)cc3)ccn2)cc(-c2cccc3c2nc(-c2cc(C(C)(C)C)ccc2O)n3-c2ccc(C(C)(C)C)cc2-c2ccccc2)c1 |
| InChI | InChI=1S/C68H65N3O/c1-65(2,3)53-33-35-60(57(43-53)46-21-14-11-15-22-46)71-61-28-20-27-56(63(61)70-64(71)58-44-54(66(4,5)6)34-36-62(58)72)48-39-49(41-55(40-48)67(7,8)9)59-42-47(37-38-69-59)45-29-31-52(32-30-45)68(10,50-23-16-12-17-24-50)51-25-18-13-19-26-51/h11-44,72H,1-10H3 |
| InChIKey | ZIDIGOWGUIDJBN-UHFFFAOYSA-N |
| XLogP | 17.71 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 940.29 |
| LogP ≤ 5 | 17.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|