C72H57N3O — CID 176838641
2-[1-(4-tert-butyl-2-phenylphenyl)-4-[3-[4-[4-(1,1-diphenylethyl)phenyl]-2-pyridinyl]phenyl]benzimidazol-2-yl]-4,6-diphenylphenol (PubChem CID 176838641) has the molecular formula C72H57N3O and a molecular weight of 980.27 g/mol. Its IUPAC name is 2-[1-(4-tert-butyl-2-phenylphenyl)-4-[3-[4-[4-(1,1-diphenylethyl)phenyl]-2-pyridinyl]phenyl]benzimidazol-2-yl]-4,6-diphenylphenol.
| Compound Name | 2-[1-(4-tert-butyl-2-phenylphenyl)-4-[3-[4-[4-(1,1-diphenylethyl)phenyl]-2-pyridinyl]phenyl]benzimidazol-2-yl]-4,6-diphenylphenol |
|---|---|
| PubChem CID | 176838641 |
| Molecular Formula | C72H57N3O |
| Molecular Weight | 980.27 g/mol |
| Exact Mass | 979.45 |
| IUPAC Name | 2-[1-(4-tert-butyl-2-phenylphenyl)-4-[3-[4-[4-(1,1-diphenylethyl)phenyl]-2-pyridinyl]phenyl]benzimidazol-2-yl]-4,6-diphenylphenol |
| SMILES | CC(C)(C)c1ccc(-n2c(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3O)nc3c(-c4cccc(-c5cc(-c6ccc(C(C)(c7ccccc7)c7ccccc7)cc6)ccn5)c4)cccc32)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C72H57N3O/c1-71(2,3)60-40-41-66(62(48-60)51-24-12-6-13-25-51)75-67-35-21-34-61(68(67)74-70(75)64-46-56(49-22-10-5-11-23-49)45-63(69(64)76)52-26-14-7-15-27-52)54-28-20-29-55(44-54)65-47-53(42-43-73-65)50-36-38-59(39-37-50)72(4,57-30-16-8-17-31-57)58-32-18-9-19-33-58/h5-48,76H,1-4H3 |
| InChIKey | PUYDMSAYQJTLQV-UHFFFAOYSA-N |
| XLogP | 18.45 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 980.27 |
| LogP ≤ 5 | 18.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|