C41H53N3OSi — CID 140931879
2,4-ditert-butyl-6-[4-[3-tert-butyl-5-(5-methyl-4-trimethylsilyl-2-pyridinyl)phenyl]-1-methylbenzimidazol-2-yl]phenol (PubChem CID 140931879) has the molecular formula C41H53N3OSi and a molecular weight of 631.98 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[4-[3-tert-butyl-5-(5-methyl-4-trimethylsilyl-2-pyridinyl)phenyl]-1-methylbenzimidazol-2-yl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[4-[3-tert-butyl-5-(5-methyl-4-trimethylsilyl-2-pyridinyl)phenyl]-1-methylbenzimidazol-2-yl]phenol |
|---|---|
| PubChem CID | 140931879 |
| Molecular Formula | C41H53N3OSi |
| Molecular Weight | 631.98 g/mol |
| Exact Mass | 631.40 |
| IUPAC Name | 2,4-ditert-butyl-6-[4-[3-tert-butyl-5-(5-methyl-4-trimethylsilyl-2-pyridinyl)phenyl]-1-methylbenzimidazol-2-yl]phenol |
| SMILES | Cc1cnc(-c2cc(-c3cccc4c3nc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3O)n4C)cc(C(C)(C)C)c2)cc1[Si](C)(C)C |
| InChI | InChI=1S/C41H53N3OSi/c1-25-24-42-33(23-35(25)46(12,13)14)27-18-26(19-28(20-27)39(2,3)4)30-16-15-17-34-36(30)43-38(44(34)11)31-21-29(40(5,6)7)22-32(37(31)45)41(8,9)10/h15-24,45H,1-14H3 |
| InChIKey | LXPSOTDIOJZHRH-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.98 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|