C36H43N3OSi — CID 140931695
2,4-ditert-butyl-6-[1-methyl-4-[3-(4-trimethylsilyl-2-pyridinyl)phenyl]benzimidazol-2-yl]phenol (PubChem CID 140931695) has the molecular formula C36H43N3OSi and a molecular weight of 561.85 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[1-methyl-4-[3-(4-trimethylsilyl-2-pyridinyl)phenyl]benzimidazol-2-yl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[1-methyl-4-[3-(4-trimethylsilyl-2-pyridinyl)phenyl]benzimidazol-2-yl]phenol |
|---|---|
| PubChem CID | 140931695 |
| Molecular Formula | C36H43N3OSi |
| Molecular Weight | 561.85 g/mol |
| Exact Mass | 561.32 |
| IUPAC Name | 2,4-ditert-butyl-6-[1-methyl-4-[3-(4-trimethylsilyl-2-pyridinyl)phenyl]benzimidazol-2-yl]phenol |
| SMILES | Cn1c(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)nc2c(-c3cccc(-c4cc([Si](C)(C)C)ccn4)c3)cccc21 |
| InChI | InChI=1S/C36H43N3OSi/c1-35(2,3)25-20-28(33(40)29(21-25)36(4,5)6)34-38-32-27(15-12-16-31(32)39(34)7)23-13-11-14-24(19-23)30-22-26(17-18-37-30)41(8,9)10/h11-22,40H,1-10H3 |
| InChIKey | SSHYAHPDXVCNDW-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.85 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|