C37H45N3OSi — CID 140931921
2,4-ditert-butyl-6-[1-methyl-4-[3-methyl-5-(4-trimethylsilyl-2-pyridinyl)phenyl]benzimidazol-2-yl]phenol (PubChem CID 140931921) has the molecular formula C37H45N3OSi and a molecular weight of 575.87 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[1-methyl-4-[3-methyl-5-(4-trimethylsilyl-2-pyridinyl)phenyl]benzimidazol-2-yl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[1-methyl-4-[3-methyl-5-(4-trimethylsilyl-2-pyridinyl)phenyl]benzimidazol-2-yl]phenol |
|---|---|
| PubChem CID | 140931921 |
| Molecular Formula | C37H45N3OSi |
| Molecular Weight | 575.87 g/mol |
| Exact Mass | 575.33 |
| IUPAC Name | 2,4-ditert-butyl-6-[1-methyl-4-[3-methyl-5-(4-trimethylsilyl-2-pyridinyl)phenyl]benzimidazol-2-yl]phenol |
| SMILES | Cc1cc(-c2cc([Si](C)(C)C)ccn2)cc(-c2cccc3c2nc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)n3C)c1 |
| InChI | InChI=1S/C37H45N3OSi/c1-23-17-24(19-25(18-23)31-22-27(15-16-38-31)42(9,10)11)28-13-12-14-32-33(28)39-35(40(32)8)29-20-26(36(2,3)4)21-30(34(29)41)37(5,6)7/h12-22,41H,1-11H3 |
| InChIKey | WCKDTWIAVZZRPD-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.87 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|