C42H45N3O2Si — CID 140832469
2,4-ditert-butyl-6-[1-methyl-4-[2-(5-trimethylsilyl-2-pyridinyl)dibenzofuran-4-yl]benzimidazol-2-yl]phenol (PubChem CID 140832469) has the molecular formula C42H45N3O2Si and a molecular weight of 651.93 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[1-methyl-4-[2-(5-trimethylsilyl-2-pyridinyl)dibenzofuran-4-yl]benzimidazol-2-yl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[1-methyl-4-[2-(5-trimethylsilyl-2-pyridinyl)dibenzofuran-4-yl]benzimidazol-2-yl]phenol |
|---|---|
| PubChem CID | 140832469 |
| Molecular Formula | C42H45N3O2Si |
| Molecular Weight | 651.93 g/mol |
| Exact Mass | 651.33 |
| IUPAC Name | 2,4-ditert-butyl-6-[1-methyl-4-[2-(5-trimethylsilyl-2-pyridinyl)dibenzofuran-4-yl]benzimidazol-2-yl]phenol |
| SMILES | Cn1c(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)nc2c(-c3cc(-c4ccc([Si](C)(C)C)cn4)cc4c3oc3ccccc34)cccc21 |
| InChI | InChI=1S/C42H45N3O2Si/c1-41(2,3)26-22-32(38(46)33(23-26)42(4,5)6)40-44-37-29(15-13-16-35(37)45(40)7)31-21-25(34-19-18-27(24-43-34)48(8,9)10)20-30-28-14-11-12-17-36(28)47-39(30)31/h11-24,46H,1-10H3 |
| InChIKey | PRYNLIPBEBONIZ-UHFFFAOYSA-N |
| XLogP | 10.71 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.93 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|