C43H33N3O2Si — CID 140832986
2-[1-naphthalen-1-yl-4-[4-(5-trimethylsilyl-2-pyridinyl)dibenzofuran-2-yl]benzimidazol-2-yl]phenol (PubChem CID 140832986) has the molecular formula C43H33N3O2Si and a molecular weight of 651.84 g/mol. Its IUPAC name is 2-[1-naphthalen-1-yl-4-[4-(5-trimethylsilyl-2-pyridinyl)dibenzofuran-2-yl]benzimidazol-2-yl]phenol.
| Compound Name | 2-[1-naphthalen-1-yl-4-[4-(5-trimethylsilyl-2-pyridinyl)dibenzofuran-2-yl]benzimidazol-2-yl]phenol |
|---|---|
| PubChem CID | 140832986 |
| Molecular Formula | C43H33N3O2Si |
| Molecular Weight | 651.84 g/mol |
| Exact Mass | 651.23 |
| IUPAC Name | 2-[1-naphthalen-1-yl-4-[4-(5-trimethylsilyl-2-pyridinyl)dibenzofuran-2-yl]benzimidazol-2-yl]phenol |
| SMILES | C[Si](C)(C)c1ccc(-c2cc(-c3cccc4c3nc(-c3ccccc3O)n4-c3cccc4ccccc34)cc3c2oc2ccccc23)nc1 |
| InChI | InChI=1S/C43H33N3O2Si/c1-49(2,3)29-22-23-36(44-26-29)35-25-28(24-34-32-15-7-9-21-40(32)48-42(34)35)31-17-11-19-38-41(31)45-43(33-16-6-8-20-39(33)47)46(38)37-18-10-13-27-12-4-5-14-30(27)37/h4-26,47H,1-3H3 |
| InChIKey | HIXWHEOZGGZFCI-UHFFFAOYSA-N |
| XLogP | 10.72 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.84 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|