C14H27NO5S — CID 140867414
3-[4-prop-2-enoyloxypentyl(propyl)amino]propane-1-sulfonic acid (PubChem CID 140867414) has the molecular formula C14H27NO5S and a molecular weight of 321.44 g/mol. Its IUPAC name is 3-[4-prop-2-enoyloxypentyl(propyl)amino]propane-1-sulfonic acid.
| Compound Name | 3-[4-prop-2-enoyloxypentyl(propyl)amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 140867414 |
| Molecular Formula | C14H27NO5S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 3-[4-prop-2-enoyloxypentyl(propyl)amino]propane-1-sulfonic acid |
| SMILES | C=CC(=O)OC(C)CCCN(CCC)CCCS(=O)(=O)O |
| InChI | InChI=1S/C14H27NO5S/c1-4-9-15(11-7-12-21(17,18)19)10-6-8-13(3)20-14(16)5-2/h5,13H,2,4,6-12H2,1,3H3,(H,17,18,19) |
| InChIKey | OVJSCQAUGAQHPG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|