C35H26FN5O2 — CID 140869574
6-(4-fluorophenyl)-1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-3-tritylimidazo[4,5-b]pyridin-2-one (PubChem CID 140869574) has the molecular formula C35H26FN5O2 and a molecular weight of 567.62 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-3-tritylimidazo[4,5-b]pyridin-2-one.
| Compound Name | 6-(4-fluorophenyl)-1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-3-tritylimidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 140869574 |
| Molecular Formula | C35H26FN5O2 |
| Molecular Weight | 567.62 g/mol |
| Exact Mass | 567.21 |
| IUPAC Name | 6-(4-fluorophenyl)-1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-3-tritylimidazo[4,5-b]pyridin-2-one |
| SMILES | Cc1nnc(Cn2c(=O)n(C(c3ccccc3)(c3ccccc3)c3ccccc3)c3ncc(-c4ccc(F)cc4)cc32)o1 |
| InChI | InChI=1S/C35H26FN5O2/c1-24-38-39-32(43-24)23-40-31-21-26(25-17-19-30(36)20-18-25)22-37-33(31)41(34(40)42)35(27-11-5-2-6-12-27,28-13-7-3-8-14-28)29-15-9-4-10-16-29/h2-22H,23H2,1H3 |
| InChIKey | DORRTDLZIQSPAV-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 78.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.62 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|