C35H26F3N3O3 — CID 140869506
ethyl 2-oxo-6-[3-(trifluoromethyl)phenyl]-3-tritylimidazo[4,5-b]pyridine-1-carboxylate (PubChem CID 140869506) has the molecular formula C35H26F3N3O3 and a molecular weight of 593.61 g/mol. Its IUPAC name is ethyl 2-oxo-6-[3-(trifluoromethyl)phenyl]-3-tritylimidazo[4,5-b]pyridine-1-carboxylate.
| Compound Name | ethyl 2-oxo-6-[3-(trifluoromethyl)phenyl]-3-tritylimidazo[4,5-b]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 140869506 |
| Molecular Formula | C35H26F3N3O3 |
| Molecular Weight | 593.61 g/mol |
| Exact Mass | 593.19 |
| IUPAC Name | ethyl 2-oxo-6-[3-(trifluoromethyl)phenyl]-3-tritylimidazo[4,5-b]pyridine-1-carboxylate |
| SMILES | CCOC(=O)n1c(=O)n(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2ncc(-c3cccc(C(F)(F)F)c3)cc21 |
| InChI | InChI=1S/C35H26F3N3O3/c1-2-44-33(43)40-30-22-25(24-13-12-20-29(21-24)35(36,37)38)23-39-31(30)41(32(40)42)34(26-14-6-3-7-15-26,27-16-8-4-9-17-27)28-18-10-5-11-19-28/h3-23H,2H2,1H3 |
| InChIKey | BNXQZJNHPMHVRT-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.61 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|