C15H14F3N3O2 — CID 68660883
2-[[3-hydroxy-5-[3-(trifluoromethyl)phenyl]-2-pyridinyl]amino]-N-methylacetamide (PubChem CID 68660883) has the molecular formula C15H14F3N3O2 and a molecular weight of 325.29 g/mol. Its IUPAC name is 2-[[3-hydroxy-5-[3-(trifluoromethyl)phenyl]-2-pyridinyl]amino]-N-methylacetamide.
| Compound Name | 2-[[3-hydroxy-5-[3-(trifluoromethyl)phenyl]-2-pyridinyl]amino]-N-methylacetamide |
|---|---|
| PubChem CID | 68660883 |
| Molecular Formula | C15H14F3N3O2 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 2-[[3-hydroxy-5-[3-(trifluoromethyl)phenyl]-2-pyridinyl]amino]-N-methylacetamide |
| SMILES | CNC(=O)CNc1ncc(-c2cccc(C(F)(F)F)c2)cc1O |
| InChI | InChI=1S/C15H14F3N3O2/c1-19-13(23)8-21-14-12(22)6-10(7-20-14)9-3-2-4-11(5-9)15(16,17)18/h2-7,22H,8H2,1H3,(H,19,23)(H,20,21) |
| InChIKey | CKYDQCQGGQEKQA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |