About (4-fluoro-2-nitrophenyl) selenocyanate
(4-fluoro-2-nitrophenyl) selenocyanate (PubChem CID 140870766) has the molecular formula C7H3FN2O2Se
and a molecular weight of 245.07 g/mol. Its IUPAC name is (4-fluoro-2-nitrophenyl) selenocyanate.
Molecular Properties
| Compound Name | (4-fluoro-2-nitrophenyl) selenocyanate |
| PubChem CID | 140870766 |
| Molecular Formula | C7H3FN2O2Se |
| Molecular Weight | 245.07 g/mol |
| Exact Mass | 245.93 |
| IUPAC Name | (4-fluoro-2-nitrophenyl) selenocyanate |
| SMILES | N#C[Se]c1ccc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H3FN2O2Se/c8-5-1-2-7(13-4-9)6(3-5)10(11)12/h1-3H |
| InChIKey | MZNPFUKQTFIPCA-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 66.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.07 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-fluoro-2-nitrophenyl) selenocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluoro-2-nitrophenyl) selenocyanate?
The IUPAC name of (4-fluoro-2-nitrophenyl) selenocyanate (CID 140870766) is (4-fluoro-2-nitrophenyl) selenocyanate.
What is the SMILES notation for (4-fluoro-2-nitrophenyl) selenocyanate?
The canonical SMILES for (4-fluoro-2-nitrophenyl) selenocyanate is N#C[Se]c1ccc(F)cc1[N+](=O)[O-].
What is the InChIKey of (4-fluoro-2-nitrophenyl) selenocyanate?
The InChIKey is MZNPFUKQTFIPCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3FN2O2Se/c8-5-1-2-7(13-4-9)6(3-5)10(11)12/h1-3H.
What are the key properties of (4-fluoro-2-nitrophenyl) selenocyanate?
(4-fluoro-2-nitrophenyl) selenocyanate has a molecular weight of 245.07 g/mol, XLogP of 0.54, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluoro-2-nitrophenyl) selenocyanate is sourced from PubChem (CID 140870766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).