C8H4FN3O4 — CID 53399258
2-(4-fluoro-2,6-dinitrophenyl)acetonitrile (PubChem CID 53399258) has the molecular formula C8H4FN3O4 and a molecular weight of 225.13 g/mol. Its IUPAC name is 2-(4-fluoro-2,6-dinitrophenyl)acetonitrile.
| Compound Name | 2-(4-fluoro-2,6-dinitrophenyl)acetonitrile |
|---|---|
| PubChem CID | 53399258 |
| Molecular Formula | C8H4FN3O4 |
| Molecular Weight | 225.13 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | 2-(4-fluoro-2,6-dinitrophenyl)acetonitrile |
| SMILES | N#CCc1c([N+](=O)[O-])cc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H4FN3O4/c9-5-3-7(11(13)14)6(1-2-10)8(4-5)12(15)16/h3-4H,1H2 |
| InChIKey | YMRGSCURJGICQS-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 110.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.13 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|