C18H20N2O6 — CID 140872760
2-[2-[[carboxy(phenyl)methyl]-hydroxyamino]ethyl-hydroxyamino]-2-phenylacetic acid (PubChem CID 140872760) has the molecular formula C18H20N2O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is 2-[2-[[carboxy(phenyl)methyl]-hydroxyamino]ethyl-hydroxyamino]-2-phenylacetic acid.
| Compound Name | 2-[2-[[carboxy(phenyl)methyl]-hydroxyamino]ethyl-hydroxyamino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 140872760 |
| Molecular Formula | C18H20N2O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 2-[2-[[carboxy(phenyl)methyl]-hydroxyamino]ethyl-hydroxyamino]-2-phenylacetic acid |
| SMILES | O=C(O)C(c1ccccc1)N(O)CCN(O)C(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C18H20N2O6/c21-17(22)15(13-7-3-1-4-8-13)19(25)11-12-20(26)16(18(23)24)14-9-5-2-6-10-14/h1-10,15-16,25-26H,11-12H2,(H,21,22)(H,23,24) |
| InChIKey | FRBYJCORNHQJTG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 121.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|