C12H15NO4 — CID 67681844
(2R)-2-[ethyl(methoxycarbonyl)amino]-2-phenylacetic acid (PubChem CID 67681844) has the molecular formula C12H15NO4 and a molecular weight of 237.26 g/mol. Its IUPAC name is (2R)-2-[ethyl(methoxycarbonyl)amino]-2-phenylacetic acid.
| Compound Name | (2R)-2-[ethyl(methoxycarbonyl)amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 67681844 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | (2R)-2-[ethyl(methoxycarbonyl)amino]-2-phenylacetic acid |
| SMILES | CCN(C(=O)OC)[C@@H](C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C12H15NO4/c1-3-13(12(16)17-2)10(11(14)15)9-7-5-4-6-8-9/h4-8,10H,3H2,1-2H3,(H,14,15)/t10-/m1/s1 |
| InChIKey | NNTFNOFQLGHEEZ-SNVBAGLBSA-N |
| XLogP | 1.90 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |