C37H29N7ORu — CID 140872995
N-methyl-1-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]methanimine oxide;bis(1,10-phenanthroline);ruthenium (PubChem CID 140872995) has the molecular formula C37H29N7ORu and a molecular weight of 688.76 g/mol. Its IUPAC name is N-methyl-1-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]methanimine oxide;bis(1,10-phenanthroline);ruthenium.
| Compound Name | N-methyl-1-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]methanimine oxide;bis(1,10-phenanthroline);ruthenium |
|---|---|
| PubChem CID | 140872995 |
| Molecular Formula | C37H29N7ORu |
| Molecular Weight | 688.76 g/mol |
| Exact Mass | 689.15 |
| IUPAC Name | N-methyl-1-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]methanimine oxide;bis(1,10-phenanthroline);ruthenium |
| SMILES | Cc1ccnc(-c2cc(/C=[N+](/C)[O-])ccn2)c1.[Ru].c1cnc2c(c1)ccc1cccnc12.c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C13H13N3O.2C12H8N2.Ru/c1-10-3-5-14-12(7-10)13-8-11(4-6-15-13)9-16(2)17;2*1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;/h3-9H,1-2H3;2*1-8H;/b16-9-;;; |
| InChIKey | NAQDEOGANYUHHT-GVKRCPFFSA-N |
| XLogP | 7.57 |
| TPSA | 103.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.76 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|