C10H21NO4 — CID 140875404
(1,3-dihydroxy-3-methylbutan-2-yl) N-tert-butylcarbamate (PubChem CID 140875404) has the molecular formula C10H21NO4 and a molecular weight of 219.28 g/mol. Its IUPAC name is (1,3-dihydroxy-3-methylbutan-2-yl) N-tert-butylcarbamate.
| Compound Name | (1,3-dihydroxy-3-methylbutan-2-yl) N-tert-butylcarbamate |
|---|---|
| PubChem CID | 140875404 |
| Molecular Formula | C10H21NO4 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | (1,3-dihydroxy-3-methylbutan-2-yl) N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC(CO)C(C)(C)O |
| InChI | InChI=1S/C10H21NO4/c1-9(2,3)11-8(13)15-7(6-12)10(4,5)14/h7,12,14H,6H2,1-5H3,(H,11,13) |
| InChIKey | QKXMEMKARIYPDJ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |