(1,3-dihydroxy-3-methylbutan-2-yl) N-tert-butylcarbamate

C10H21NO4 — CID 140875404

IUPAC(1,3-dihydroxy-3-methylbutan-2-yl) N-tert-butylcarbamate
SMILESCC(C)(C)NC(=O)OC(CO)C(C)(C)O
InChIInChI=1S/C10H21NO4/c1-9(2,3)11-8(13)15-7(6-12)10(4,5)14/h7,12,14H,6H2,1-5H3,(H,11,13)
InChIKeyQKXMEMKARIYPDJ-UHFFFAOYSA-N
MW219.28 g/mol
LogP0.64
Rot. Bonds3

About (1,3-dihydroxy-3-methylbutan-2-yl) N-tert-butylcarbamate

(1,3-dihydroxy-3-methylbutan-2-yl) N-tert-butylcarbamate (PubChem CID 140875404) has the molecular formula C10H21NO4 and a molecular weight of 219.28 g/mol. Its IUPAC name is (1,3-dihydroxy-3-methylbutan-2-yl) N-tert-butylcarbamate.

Molecular Properties

Compound Name(1,3-dihydroxy-3-methylbutan-2-yl) N-tert-butylcarbamate
PubChem CID140875404
Molecular FormulaC10H21NO4
Molecular Weight219.28 g/mol
Exact Mass219.15
IUPAC Name(1,3-dihydroxy-3-methylbutan-2-yl) N-tert-butylcarbamate
SMILESCC(C)(C)NC(=O)OC(CO)C(C)(C)O
InChIInChI=1S/C10H21NO4/c1-9(2,3)11-8(13)15-7(6-12)10(4,5)14/h7,12,14H,6H2,1-5H3,(H,11,13)
InChIKeyQKXMEMKARIYPDJ-UHFFFAOYSA-N
XLogP0.64
TPSA78.79 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.28
LogP ≤ 50.64
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze (1,3-dihydroxy-3-methylbutan-2-yl) N-tert-butylcarbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1,3-dihydroxy-3-methylbutan-2-yl) N-tert-butylcarbamate?
The IUPAC name of (1,3-dihydroxy-3-methylbutan-2-yl) N-tert-butylcarbamate (CID 140875404) is (1,3-dihydroxy-3-methylbutan-2-yl) N-tert-butylcarbamate.
What is the SMILES notation for (1,3-dihydroxy-3-methylbutan-2-yl) N-tert-butylcarbamate?
The canonical SMILES for (1,3-dihydroxy-3-methylbutan-2-yl) N-tert-butylcarbamate is CC(C)(C)NC(=O)OC(CO)C(C)(C)O.
What is the InChIKey of (1,3-dihydroxy-3-methylbutan-2-yl) N-tert-butylcarbamate?
The InChIKey is QKXMEMKARIYPDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO4/c1-9(2,3)11-8(13)15-7(6-12)10(4,5)14/h7,12,14H,6H2,1-5H3,(H,11,13).
What are the key properties of (1,3-dihydroxy-3-methylbutan-2-yl) N-tert-butylcarbamate?
(1,3-dihydroxy-3-methylbutan-2-yl) N-tert-butylcarbamate has a molecular weight of 219.28 g/mol, XLogP of 0.64, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-dihydroxy-3-methylbutan-2-yl) N-tert-butylcarbamate is sourced from PubChem (CID 140875404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).