C27H39NO5Si — CID 140876043
tert-butyl (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(hydroxymethyl)morpholine-4-carboxylate (PubChem CID 140876043) has the molecular formula C27H39NO5Si and a molecular weight of 485.70 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(hydroxymethyl)morpholine-4-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(hydroxymethyl)morpholine-4-carboxylate |
|---|---|
| PubChem CID | 140876043 |
| Molecular Formula | C27H39NO5Si |
| Molecular Weight | 485.70 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | tert-butyl (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(hydroxymethyl)morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(CO)O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1 |
| InChI | InChI=1S/C27H39NO5Si/c1-26(2,3)33-25(30)28-17-21(19-29)32-22(18-28)20-31-34(27(4,5)6,23-13-9-7-10-14-23)24-15-11-8-12-16-24/h7-16,21-22,29H,17-20H2,1-6H3/t21?,22-/m0/s1 |
| InChIKey | UUBBBMFXOULNPN-KEKNWZKVSA-N |
| XLogP | 3.56 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.70 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|