About 9,9-dimethyl-8-(3-methyl-2H-imidazol-1-yl)indeno[2,1-c]pyridine
9,9-dimethyl-8-(3-methyl-2H-imidazol-1-yl)indeno[2,1-c]pyridine (PubChem CID 140877669) has the molecular formula C18H19N3
and a molecular weight of 277.37 g/mol. Its IUPAC name is 9,9-dimethyl-8-(3-methyl-2H-imidazol-1-yl)indeno[2,1-c]pyridine.
Molecular Properties
| Compound Name | 9,9-dimethyl-8-(3-methyl-2H-imidazol-1-yl)indeno[2,1-c]pyridine |
| PubChem CID | 140877669 |
| Molecular Formula | C18H19N3 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 9,9-dimethyl-8-(3-methyl-2H-imidazol-1-yl)indeno[2,1-c]pyridine |
| SMILES | CN1C=CN(c2cccc3c2C(C)(C)c2cnccc2-3)C1 |
| InChI | InChI=1S/C18H19N3/c1-18(2)15-11-19-8-7-13(15)14-5-4-6-16(17(14)18)21-10-9-20(3)12-21/h4-11H,12H2,1-3H3 |
| InChIKey | UAXFITUPIOIDLP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9,9-dimethyl-8-(3-methyl-2H-imidazol-1-yl)indeno[2,1-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,9-dimethyl-8-(3-methyl-2H-imidazol-1-yl)indeno[2,1-c]pyridine?
The IUPAC name of 9,9-dimethyl-8-(3-methyl-2H-imidazol-1-yl)indeno[2,1-c]pyridine (CID 140877669) is 9,9-dimethyl-8-(3-methyl-2H-imidazol-1-yl)indeno[2,1-c]pyridine.
What is the SMILES notation for 9,9-dimethyl-8-(3-methyl-2H-imidazol-1-yl)indeno[2,1-c]pyridine?
The canonical SMILES for 9,9-dimethyl-8-(3-methyl-2H-imidazol-1-yl)indeno[2,1-c]pyridine is CN1C=CN(c2cccc3c2C(C)(C)c2cnccc2-3)C1.
What is the InChIKey of 9,9-dimethyl-8-(3-methyl-2H-imidazol-1-yl)indeno[2,1-c]pyridine?
The InChIKey is UAXFITUPIOIDLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3/c1-18(2)15-11-19-8-7-13(15)14-5-4-6-16(17(14)18)21-10-9-20(3)12-21/h4-11H,12H2,1-3H3.
What are the key properties of 9,9-dimethyl-8-(3-methyl-2H-imidazol-1-yl)indeno[2,1-c]pyridine?
9,9-dimethyl-8-(3-methyl-2H-imidazol-1-yl)indeno[2,1-c]pyridine has a molecular weight of 277.37 g/mol, XLogP of 3.57, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9,9-dimethyl-8-(3-methyl-2H-imidazol-1-yl)indeno[2,1-c]pyridine is sourced from PubChem (CID 140877669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).