C36H17N5O — CID 140878308
3-[2-([1]benzofuro[2,3-b]indol-6-yl)-3-(3-cyano-5-isocyanophenyl)phenyl]-5-isocyanobenzonitrile (PubChem CID 140878308) has the molecular formula C36H17N5O and a molecular weight of 535.57 g/mol. Its IUPAC name is 3-[2-([1]benzofuro[2,3-b]indol-6-yl)-3-(3-cyano-5-isocyanophenyl)phenyl]-5-isocyanobenzonitrile.
| Compound Name | 3-[2-([1]benzofuro[2,3-b]indol-6-yl)-3-(3-cyano-5-isocyanophenyl)phenyl]-5-isocyanobenzonitrile |
|---|---|
| PubChem CID | 140878308 |
| Molecular Formula | C36H17N5O |
| Molecular Weight | 535.57 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | 3-[2-([1]benzofuro[2,3-b]indol-6-yl)-3-(3-cyano-5-isocyanophenyl)phenyl]-5-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)cc(-c2cccc(-c3cc(C#N)cc([N+]#[C-])c3)c2-n2c3ccccc3c3c4ccccc4oc32)c1 |
| InChI | InChI=1S/C36H17N5O/c1-39-26-16-22(20-37)14-24(18-26)28-10-7-11-29(25-15-23(21-38)17-27(19-25)40-2)35(28)41-32-12-5-3-8-30(32)34-31-9-4-6-13-33(31)42-36(34)41/h3-19H |
| InChIKey | UWLIXEHXSBSFRT-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 74.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.57 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|