C26H17N7O2 — CID 140879512
6-amino-4-(4-imidazol-1-ylphenyl)-3-(5-isocyano-1-benzofuran-2-yl)-1-methyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile (PubChem CID 140879512) has the molecular formula C26H17N7O2 and a molecular weight of 459.47 g/mol. Its IUPAC name is 6-amino-4-(4-imidazol-1-ylphenyl)-3-(5-isocyano-1-benzofuran-2-yl)-1-methyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile.
| Compound Name | 6-amino-4-(4-imidazol-1-ylphenyl)-3-(5-isocyano-1-benzofuran-2-yl)-1-methyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 140879512 |
| Molecular Formula | C26H17N7O2 |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 6-amino-4-(4-imidazol-1-ylphenyl)-3-(5-isocyano-1-benzofuran-2-yl)-1-methyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2oc(-c3nn(C)c4c3C(c3ccc(-n5ccnc5)cc3)C(C#N)=C(N)O4)cc2c1 |
| InChI | InChI=1S/C26H17N7O2/c1-29-17-5-8-20-16(11-17)12-21(34-20)24-23-22(19(13-27)25(28)35-26(23)32(2)31-24)15-3-6-18(7-4-15)33-10-9-30-14-33/h3-12,14,22H,28H2,2H3 |
| InChIKey | NIDQDCMWZCBOSB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_B(9)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|