C23H17N5O2 — CID 135133022
6-hydroxy-4-(4-imidazol-1-ylphenyl)-1-methyl-3-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile (PubChem CID 135133022) has the molecular formula C23H17N5O2 and a molecular weight of 395.42 g/mol. Its IUPAC name is 6-hydroxy-4-(4-imidazol-1-ylphenyl)-1-methyl-3-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile.
| Compound Name | 6-hydroxy-4-(4-imidazol-1-ylphenyl)-1-methyl-3-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 135133022 |
| Molecular Formula | C23H17N5O2 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 6-hydroxy-4-(4-imidazol-1-ylphenyl)-1-methyl-3-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
| SMILES | Cn1nc(-c2ccccc2)c2c1OC(O)=C(C#N)C2c1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C23H17N5O2/c1-27-22-20(21(26-27)16-5-3-2-4-6-16)19(18(13-24)23(29)30-22)15-7-9-17(10-8-15)28-12-11-25-14-28/h2-12,14,19,29H,1H3 |
| InChIKey | KDOJTHHZBURZGA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_B(9)', 'substructure': 'N/A'} |
|---|