C20H18N4O — CID 41673734
4-(Imidazol-1-ylmethyl)-3-(4-methoxyphenyl)-1-phenyl-pyrazole (PubChem CID 41673734) has the molecular formula C20H18N4O and a molecular weight of 330.40 g/mol. Its IUPAC name is 4-(imidazol-1-ylmethyl)-3-(4-methoxyphenyl)-1-phenylpyrazole.
| Compound Name | 4-(Imidazol-1-ylmethyl)-3-(4-methoxyphenyl)-1-phenyl-pyrazole |
|---|---|
| PubChem CID | 41673734 |
| Molecular Formula | C20H18N4O |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 4-(imidazol-1-ylmethyl)-3-(4-methoxyphenyl)-1-phenylpyrazole |
| SMILES | COC1=CC=C(C=C1)C2=NN(C=C2CN3C=CN=C3)C4=CC=CC=C4 |
| InChI | InChI=1S/C20H18N4O/c1-25-19-9-7-16(8-10-19)20-17(13-23-12-11-21-15-23)14-24(22-20)18-5-3-2-4-6-18/h2-12,14-15H,13H2,1H3 |
| InChIKey | CZOCKHTYPCJURT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 44.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | 407 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |