C17H21BCl2N2O4 — CID 140880321
[(1R)-2-(2,4-dichlorophenyl)-1-[[(2R)-1-prop-2-enoylpiperidine-2-carbonyl]amino]ethyl]boronic acid (PubChem CID 140880321) has the molecular formula C17H21BCl2N2O4 and a molecular weight of 399.08 g/mol. Its IUPAC name is [(1R)-2-(2,4-dichlorophenyl)-1-[[(2R)-1-prop-2-enoylpiperidine-2-carbonyl]amino]ethyl]boronic acid.
| Compound Name | [(1R)-2-(2,4-dichlorophenyl)-1-[[(2R)-1-prop-2-enoylpiperidine-2-carbonyl]amino]ethyl]boronic acid |
|---|---|
| PubChem CID | 140880321 |
| Molecular Formula | C17H21BCl2N2O4 |
| Molecular Weight | 399.08 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | [(1R)-2-(2,4-dichlorophenyl)-1-[[(2R)-1-prop-2-enoylpiperidine-2-carbonyl]amino]ethyl]boronic acid |
| SMILES | C=CC(=O)N1CCCC[C@@H]1C(=O)N[C@@H](Cc1ccc(Cl)cc1Cl)B(O)O |
| InChI | InChI=1S/C17H21BCl2N2O4/c1-2-16(23)22-8-4-3-5-14(22)17(24)21-15(18(25)26)9-11-6-7-12(19)10-13(11)20/h2,6-7,10,14-15,25-26H,1,3-5,8-9H2,(H,21,24)/t14-,15+/m1/s1 |
| InChIKey | YMDDNKYFBGZHJL-CABCVRRESA-N |
| XLogP | 1.60 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.08 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|