C39H55N2O10S3+ — CID 140880526
[4-tert-butyl-2-[(E,3Z)-3-[3-methyl-3-(4-methylpentyl)-5-sulfo-1-(3-sulfopropyl)indol-2-ylidene]prop-1-enyl]chromen-7-ylidene]-ethyl-(3-sulfopropyl)azanium (PubChem CID 140880526) has the molecular formula C39H55N2O10S3+ and a molecular weight of 808.07 g/mol. Its IUPAC name is [4-tert-butyl-2-[(E,3Z)-3-[3-methyl-3-(4-methylpentyl)-5-sulfo-1-(3-sulfopropyl)indol-2-ylidene]prop-1-enyl]chromen-7-ylidene]-ethyl-(3-sulfopropyl)azanium.
| Compound Name | [4-tert-butyl-2-[(E,3Z)-3-[3-methyl-3-(4-methylpentyl)-5-sulfo-1-(3-sulfopropyl)indol-2-ylidene]prop-1-enyl]chromen-7-ylidene]-ethyl-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 140880526 |
| Molecular Formula | C39H55N2O10S3+ |
| Molecular Weight | 808.07 g/mol |
| Exact Mass | 807.30 |
| IUPAC Name | [4-tert-butyl-2-[(E,3Z)-3-[3-methyl-3-(4-methylpentyl)-5-sulfo-1-(3-sulfopropyl)indol-2-ylidene]prop-1-enyl]chromen-7-ylidene]-ethyl-(3-sulfopropyl)azanium |
| SMILES | CC/[N+](CCCS(=O)(=O)O)=c1/ccc2c(C(C)(C)C)cc(/C=C/C=C3\N(CCCS(=O)(=O)O)c4ccc(S(=O)(=O)O)cc4C3(C)CCCC(C)C)oc-2c1 |
| InChI | InChI=1S/C39H54N2O10S3/c1-8-40(21-11-23-52(42,43)44)29-16-18-32-33(38(4,5)6)26-30(51-36(32)25-29)14-9-15-37-39(7,20-10-13-28(2)3)34-27-31(54(48,49)50)17-19-35(34)41(37)22-12-24-53(45,46)47/h9,14-19,25-28H,8,10-13,20-24H2,1-7H3,(H2-,42,43,44,45,46,47,48,49,50)/p+1 |
| InChIKey | UEDCOGBPWVBNNZ-UHFFFAOYSA-O |
| XLogP | 6.78 |
| TPSA | 182.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.07 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|