C25H34BClN4O5 — CID 140881929
tert-butyl 2-[[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoyl]-1-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carboxylate (PubChem CID 140881929) has the molecular formula C25H34BClN4O5 and a molecular weight of 516.84 g/mol. Its IUPAC name is tert-butyl 2-[[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoyl]-1-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl 2-[[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoyl]-1-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 140881929 |
| Molecular Formula | C25H34BClN4O5 |
| Molecular Weight | 516.84 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | tert-butyl 2-[[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoyl]-1-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carboxylate |
| SMILES | Cn1c(C(=O)Nc2cccc(B3OC(C)(C)C(C)(C)O3)c2Cl)nc2c1CCN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C25H34BClN4O5/c1-23(2,3)34-22(33)31-13-12-18-17(14-31)28-20(30(18)8)21(32)29-16-11-9-10-15(19(16)27)26-35-24(4,5)25(6,7)36-26/h9-11H,12-14H2,1-8H3,(H,29,32) |
| InChIKey | WFGKNEWPYIADIG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.84 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|