C26H35BClN3O5 — CID 158191258
tert-butyl 2-[2-[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetyl]-1-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carboxylate (PubChem CID 158191258) has the molecular formula C26H35BClN3O5 and a molecular weight of 515.85 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetyl]-1-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl 2-[2-[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetyl]-1-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 158191258 |
| Molecular Formula | C26H35BClN3O5 |
| Molecular Weight | 515.85 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | tert-butyl 2-[2-[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetyl]-1-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carboxylate |
| SMILES | Cn1c(C(=O)Cc2cccc(B3OC(C)(C)C(C)(C)O3)c2Cl)nc2c1CCN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C26H35BClN3O5/c1-24(2,3)34-23(33)31-13-12-19-18(15-31)29-22(30(19)8)20(32)14-16-10-9-11-17(21(16)28)27-35-25(4,5)26(6,7)36-27/h9-11H,12-15H2,1-8H3 |
| InChIKey | FZTYABRVIOPTBN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 82.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.85 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|