C21H36Cl2N4O2 — CID 140882615
2-[1-[7-chloro-6-(4-chlorocyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-yl]piperidin-4-yl]-N-hydroxyacetamide (PubChem CID 140882615) has the molecular formula C21H36Cl2N4O2 and a molecular weight of 447.45 g/mol. Its IUPAC name is 2-[1-[7-chloro-6-(4-chlorocyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-yl]piperidin-4-yl]-N-hydroxyacetamide.
| Compound Name | 2-[1-[7-chloro-6-(4-chlorocyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-yl]piperidin-4-yl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 140882615 |
| Molecular Formula | C21H36Cl2N4O2 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 2-[1-[7-chloro-6-(4-chlorocyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinazolin-4-yl]piperidin-4-yl]-N-hydroxyacetamide |
| SMILES | O=C(CC1CCN(C2NCNC3CC(Cl)C(C4CCC(Cl)CC4)CC32)CC1)NO |
| InChI | InChI=1S/C21H36Cl2N4O2/c22-15-3-1-14(2-4-15)16-10-17-19(11-18(16)23)24-12-25-21(17)27-7-5-13(6-8-27)9-20(28)26-29/h13-19,21,24-25,29H,1-12H2,(H,26,28) |
| InChIKey | CBDSWXDQKYXKIW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|