C28H40N3+3 — CID 140885398
2,3-bis(1-hexylpyridin-1-ium-4-yl)-1-methylpyridin-1-ium (PubChem CID 140885398) has the molecular formula C28H40N3+3 and a molecular weight of 418.65 g/mol. Its IUPAC name is 2,3-bis(1-hexylpyridin-1-ium-4-yl)-1-methylpyridin-1-ium.
| Compound Name | 2,3-bis(1-hexylpyridin-1-ium-4-yl)-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 140885398 |
| Molecular Formula | C28H40N3+3 |
| Molecular Weight | 418.65 g/mol |
| Exact Mass | 418.32 |
| IUPAC Name | 2,3-bis(1-hexylpyridin-1-ium-4-yl)-1-methylpyridin-1-ium |
| SMILES | CCCCCC[n+]1ccc(-c2ccc[n+](C)c2-c2cc[n+](CCCCCC)cc2)cc1 |
| InChI | InChI=1S/C28H40N3/c1-4-6-8-10-19-30-21-14-25(15-22-30)27-13-12-18-29(3)28(27)26-16-23-31(24-17-26)20-11-9-7-5-2/h12-18,21-24H,4-11,19-20H2,1-3H3/q+3 |
| InChIKey | RVEBYVSQOLURBD-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 11.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.65 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|