C22H34 — CID 140886931
(8Z,12Z)-10,11-dimethylicosa-8,12-dien-1,19-diyne (PubChem CID 140886931) has the molecular formula C22H34 and a molecular weight of 298.51 g/mol. Its IUPAC name is (8Z,12Z)-10,11-dimethylicosa-8,12-dien-1,19-diyne.
| Compound Name | (8Z,12Z)-10,11-dimethylicosa-8,12-dien-1,19-diyne |
|---|---|
| PubChem CID | 140886931 |
| Molecular Formula | C22H34 |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | (8Z,12Z)-10,11-dimethylicosa-8,12-dien-1,19-diyne |
| SMILES | C#CCCCCC/C=C\C(C)C(C)/C=C\CCCCCC#C |
| InChI | InChI=1S/C22H34/c1-5-7-9-11-13-15-17-19-21(3)22(4)20-18-16-14-12-10-8-6-2/h1-2,17-22H,7-16H2,3-4H3/b19-17-,20-18- |
| InChIKey | XGBPAOZRODCUNA-CLFAGFIQSA-N |
| XLogP | 6.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|