C9H9Cl3NO+ — CID 140886951
(2,2,2-trichloro-1-phenylmethoxyethylidene)azanium (PubChem CID 140886951) has the molecular formula C9H9Cl3NO+ and a molecular weight of 253.54 g/mol. Its IUPAC name is (2,2,2-trichloro-1-phenylmethoxyethylidene)azanium.
| Compound Name | (2,2,2-trichloro-1-phenylmethoxyethylidene)azanium |
|---|---|
| PubChem CID | 140886951 |
| Molecular Formula | C9H9Cl3NO+ |
| Molecular Weight | 253.54 g/mol |
| Exact Mass | 251.97 |
| IUPAC Name | (2,2,2-trichloro-1-phenylmethoxyethylidene)azanium |
| SMILES | [NH2+]=C(OCc1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H8Cl3NO/c10-9(11,12)8(13)14-6-7-4-2-1-3-5-7/h1-5,13H,6H2/p+1 |
| InChIKey | HUZCTWYDQIQZPM-UHFFFAOYSA-O |
| XLogP | 1.73 |
| TPSA | 34.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.54 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|