C6H14Cl7NSi3 — CID 140887893
N-[chloro-bis(trichlorosilyl)silyl]-N-propan-2-ylpropan-2-amine (PubChem CID 140887893) has the molecular formula C6H14Cl7NSi3 and a molecular weight of 432.61 g/mol. Its IUPAC name is N-[chloro-bis(trichlorosilyl)silyl]-N-propan-2-ylpropan-2-amine.
| Compound Name | N-[chloro-bis(trichlorosilyl)silyl]-N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 140887893 |
| Molecular Formula | C6H14Cl7NSi3 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 428.83 |
| IUPAC Name | N-[chloro-bis(trichlorosilyl)silyl]-N-propan-2-ylpropan-2-amine |
| SMILES | CC(C)N(C(C)C)[Si](Cl)([Si](Cl)(Cl)Cl)[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C6H14Cl7NSi3/c1-5(2)14(6(3)4)17(13,15(7,8)9)16(10,11)12/h5-6H,1-4H3 |
| InChIKey | FXTNCLFPMARZPO-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|