C26H19- — CID 140887937
2-cyclohexa-1,5-dien-1-yl-7-phenylphenanthrene (PubChem CID 140887937) has the molecular formula C26H19- and a molecular weight of 331.44 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-7-phenylphenanthrene.
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-7-phenylphenanthrene |
|---|---|
| PubChem CID | 140887937 |
| Molecular Formula | C26H19- |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-7-phenylphenanthrene |
| SMILES | C1=CC(c2ccc3c(ccc4cc(-c5ccccc5)ccc43)c2)=C[CH-]C1 |
| InChI | InChI=1S/C26H19/c1-3-7-19(8-4-1)21-13-15-25-23(17-21)11-12-24-18-22(14-16-26(24)25)20-9-5-2-6-10-20/h1,3-18H,2H2/q-1 |
| InChIKey | MJZQDUQHIVKTPR-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|