C23H26ClFN4O — CID 140890170
2-(5-chloro-2-fluorophenyl)-5-propan-2-yl-N-[3-[(propan-2-yloxyamino)methyl]-4-pyridinyl]pyridin-4-amine (PubChem CID 140890170) has the molecular formula C23H26ClFN4O and a molecular weight of 428.94 g/mol. Its IUPAC name is 2-(5-chloro-2-fluorophenyl)-5-propan-2-yl-N-[3-[(propan-2-yloxyamino)methyl]-4-pyridinyl]pyridin-4-amine.
| Compound Name | 2-(5-chloro-2-fluorophenyl)-5-propan-2-yl-N-[3-[(propan-2-yloxyamino)methyl]-4-pyridinyl]pyridin-4-amine |
|---|---|
| PubChem CID | 140890170 |
| Molecular Formula | C23H26ClFN4O |
| Molecular Weight | 428.94 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 2-(5-chloro-2-fluorophenyl)-5-propan-2-yl-N-[3-[(propan-2-yloxyamino)methyl]-4-pyridinyl]pyridin-4-amine |
| SMILES | CC(C)ONCc1cnccc1Nc1cc(-c2cc(Cl)ccc2F)ncc1C(C)C |
| InChI | InChI=1S/C23H26ClFN4O/c1-14(2)19-13-27-22(18-9-17(24)5-6-20(18)25)10-23(19)29-21-7-8-26-11-16(21)12-28-30-15(3)4/h5-11,13-15,28H,12H2,1-4H3,(H,26,27,29) |
| InChIKey | ILYSLEVHMHUSIL-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.94 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|