C27H32F2N4O — CID 144881563
but-2-ene;4-[[2-(2,5-difluorophenyl)-5-propan-2-yl-4-pyridinyl]amino]-N-propylpyridine-3-carboxamide (PubChem CID 144881563) has the molecular formula C27H32F2N4O and a molecular weight of 466.58 g/mol. Its IUPAC name is but-2-ene;4-[[2-(2,5-difluorophenyl)-5-propan-2-yl-4-pyridinyl]amino]-N-propylpyridine-3-carboxamide.
| Compound Name | but-2-ene;4-[[2-(2,5-difluorophenyl)-5-propan-2-yl-4-pyridinyl]amino]-N-propylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 144881563 |
| Molecular Formula | C27H32F2N4O |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | but-2-ene;4-[[2-(2,5-difluorophenyl)-5-propan-2-yl-4-pyridinyl]amino]-N-propylpyridine-3-carboxamide |
| SMILES | CC=CC.CCCNC(=O)c1cnccc1Nc1cc(-c2cc(F)ccc2F)ncc1C(C)C |
| InChI | InChI=1S/C23H24F2N4O.C4H8/c1-4-8-27-23(30)18-12-26-9-7-20(18)29-22-11-21(28-13-17(22)14(2)3)16-10-15(24)5-6-19(16)25;1-3-4-2/h5-7,9-14H,4,8H2,1-3H3,(H,27,30)(H,26,28,29);3-4H,1-2H3 |
| InChIKey | GXKGEHLDHDYLNN-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|