C21H25ClFN5O — CID 155016279
(E)-3-amino-2-[N'-[2-(5-chloro-2-fluorophenyl)-5-propan-2-yl-4-pyridinyl]carbamimidoyl]-N-propylprop-2-enamide (PubChem CID 155016279) has the molecular formula C21H25ClFN5O and a molecular weight of 417.92 g/mol. Its IUPAC name is (E)-3-amino-2-[N'-[2-(5-chloro-2-fluorophenyl)-5-propan-2-yl-4-pyridinyl]carbamimidoyl]-N-propylprop-2-enamide.
| Compound Name | (E)-3-amino-2-[N'-[2-(5-chloro-2-fluorophenyl)-5-propan-2-yl-4-pyridinyl]carbamimidoyl]-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 155016279 |
| Molecular Formula | C21H25ClFN5O |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | (E)-3-amino-2-[N'-[2-(5-chloro-2-fluorophenyl)-5-propan-2-yl-4-pyridinyl]carbamimidoyl]-N-propylprop-2-enamide |
| SMILES | CCCNC(=O)C(=C/N)/C(N)=N/c1cc(-c2cc(Cl)ccc2F)ncc1C(C)C |
| InChI | InChI=1S/C21H25ClFN5O/c1-4-7-26-21(29)15(10-24)20(25)28-19-9-18(27-11-16(19)12(2)3)14-8-13(22)5-6-17(14)23/h5-6,8-12H,4,7,24H2,1-3H3,(H,26,29)(H2,25,27,28)/b15-10+ |
| InChIKey | AOPZVKSLHZHKPW-XNTDXEJSSA-N |
| XLogP | 4.02 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|